C29H38N8O3 — CID 162027426
N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(3-methylindol-1-yl)pyrimidin-5-yl]propanamide;methane (PubChem CID 162027426) has the molecular formula C29H38N8O3 and a molecular weight of 546.68 g/mol. Its IUPAC name is N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(3-methylindol-1-yl)pyrimidin-5-yl]propanamide;methane.
| Compound Name | N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(3-methylindol-1-yl)pyrimidin-5-yl]propanamide;methane |
|---|---|
| PubChem CID | 162027426 |
| Molecular Formula | C29H38N8O3 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(3-methylindol-1-yl)pyrimidin-5-yl]propanamide;methane |
| SMILES | C.CCC(=O)Nc1cnc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2C)nc1-n1cc(C)c2ccccc21 |
| InChI | InChI=1S/C28H34N8O3.CH4/c1-7-26(37)30-22-16-29-28(32-27(22)35-17-19(3)20-10-8-9-11-23(20)35)31-21-15-25(36(38)39)24(14-18(21)2)34(6)13-12-33(4)5;/h8-11,14-17H,7,12-13H2,1-6H3,(H,30,37)(H,29,31,32);1H4 |
| InChIKey | YVOJMEPQXGOKBC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|