C31H42N8O3 — CID 157246123
N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidin-5-yl]-2,2-dimethylpropanamide;methane (PubChem CID 157246123) has the molecular formula C31H42N8O3 and a molecular weight of 574.73 g/mol. Its IUPAC name is N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidin-5-yl]-2,2-dimethylpropanamide;methane.
| Compound Name | N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidin-5-yl]-2,2-dimethylpropanamide;methane |
|---|---|
| PubChem CID | 157246123 |
| Molecular Formula | C31H42N8O3 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidin-5-yl]-2,2-dimethylpropanamide;methane |
| SMILES | C.Cc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(NC(=O)C(C)(C)C)c(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C30H38N8O3.CH4/c1-19-15-25(36(7)14-13-35(5)6)26(38(40)41)16-22(19)33-29-31-17-23(32-28(39)30(2,3)4)27(34-29)21-18-37(8)24-12-10-9-11-20(21)24;/h9-12,15-18H,13-14H2,1-8H3,(H,32,39)(H,31,33,34);1H4 |
| InChIKey | AVUCVCFYRJLRTQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|