C28H35N7O4 — CID 159197927
carbon dioxide;4-N-[2-(dimethylamino)ethyl]-1-N-[4-(1,4-dimethylindol-3-yl)pyrimidin-2-yl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine;methane (PubChem CID 159197927) has the molecular formula C28H35N7O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is carbon dioxide;4-N-[2-(dimethylamino)ethyl]-1-N-[4-(1,4-dimethylindol-3-yl)pyrimidin-2-yl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine;methane.
| Compound Name | carbon dioxide;4-N-[2-(dimethylamino)ethyl]-1-N-[4-(1,4-dimethylindol-3-yl)pyrimidin-2-yl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine;methane |
|---|---|
| PubChem CID | 159197927 |
| Molecular Formula | C28H35N7O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | carbon dioxide;4-N-[2-(dimethylamino)ethyl]-1-N-[4-(1,4-dimethylindol-3-yl)pyrimidin-2-yl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine;methane |
| SMILES | C.Cc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2cn(C)c3cccc(C)c23)n1.O=C=O |
| InChI | InChI=1S/C26H31N7O2.CO2.CH4/c1-17-8-7-9-22-25(17)19(16-32(22)6)20-10-11-27-26(28-20)29-21-15-24(33(34)35)23(14-18(21)2)31(5)13-12-30(3)4;2-1-3;/h7-11,14-16H,12-13H2,1-6H3,(H,27,28,29);;1H4 |
| InChIKey | KOXCTNCGAJWABG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|