C22H18FN5O4 — CID 158143329
carbon dioxide;4-(1,4-dimethylindol-3-yl)-N-(4-fluoro-2-methyl-5-nitrophenyl)pyrimidin-2-amine (PubChem CID 158143329) has the molecular formula C22H18FN5O4 and a molecular weight of 435.42 g/mol. Its IUPAC name is carbon dioxide;4-(1,4-dimethylindol-3-yl)-N-(4-fluoro-2-methyl-5-nitrophenyl)pyrimidin-2-amine.
| Compound Name | carbon dioxide;4-(1,4-dimethylindol-3-yl)-N-(4-fluoro-2-methyl-5-nitrophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 158143329 |
| Molecular Formula | C22H18FN5O4 |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | carbon dioxide;4-(1,4-dimethylindol-3-yl)-N-(4-fluoro-2-methyl-5-nitrophenyl)pyrimidin-2-amine |
| SMILES | Cc1cc(F)c([N+](=O)[O-])cc1Nc1nccc(-c2cn(C)c3cccc(C)c23)n1.O=C=O |
| InChI | InChI=1S/C21H18FN5O2.CO2/c1-12-5-4-6-18-20(12)14(11-26(18)3)16-7-8-23-21(24-16)25-17-10-19(27(28)29)15(22)9-13(17)2;2-1-3/h4-11H,1-3H3,(H,23,24,25); |
| InChIKey | FUFDSWQCZVEYGE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|