C22H21FN6O3 — CID 161177840
2-[3-[2-(4-fluoro-2-methyl-5-nitroanilino)pyrimidin-4-yl]indol-1-yl]acetamide;methane (PubChem CID 161177840) has the molecular formula C22H21FN6O3 and a molecular weight of 436.45 g/mol. Its IUPAC name is 2-[3-[2-(4-fluoro-2-methyl-5-nitroanilino)pyrimidin-4-yl]indol-1-yl]acetamide;methane.
| Compound Name | 2-[3-[2-(4-fluoro-2-methyl-5-nitroanilino)pyrimidin-4-yl]indol-1-yl]acetamide;methane |
|---|---|
| PubChem CID | 161177840 |
| Molecular Formula | C22H21FN6O3 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[3-[2-(4-fluoro-2-methyl-5-nitroanilino)pyrimidin-4-yl]indol-1-yl]acetamide;methane |
| SMILES | C.Cc1cc(F)c([N+](=O)[O-])cc1Nc1nccc(-c2cn(CC(N)=O)c3ccccc23)n1 |
| InChI | InChI=1S/C21H17FN6O3.CH4/c1-12-8-15(22)19(28(30)31)9-17(12)26-21-24-7-6-16(25-21)14-10-27(11-20(23)29)18-5-3-2-4-13(14)18;/h2-10H,11H2,1H3,(H2,23,29)(H,24,25,26);1H4 |
| InChIKey | USAYEFMKGRZARN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|