C27H34N8O3 — CID 159212255
2-[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]pyrimidin-4-yl]indol-1-yl]acetamide;methane (PubChem CID 159212255) has the molecular formula C27H34N8O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is 2-[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]pyrimidin-4-yl]indol-1-yl]acetamide;methane.
| Compound Name | 2-[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]pyrimidin-4-yl]indol-1-yl]acetamide;methane |
|---|---|
| PubChem CID | 159212255 |
| Molecular Formula | C27H34N8O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 2-[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]pyrimidin-4-yl]indol-1-yl]acetamide;methane |
| SMILES | C.Cc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2cn(CC(N)=O)c3ccccc23)n1 |
| InChI | InChI=1S/C26H30N8O3.CH4/c1-17-13-23(32(4)12-11-31(2)3)24(34(36)37)14-21(17)30-26-28-10-9-20(29-26)19-15-33(16-25(27)35)22-8-6-5-7-18(19)22;/h5-10,13-15H,11-12,16H2,1-4H3,(H2,27,35)(H,28,29,30);1H4 |
| InChIKey | KQQCZRQOLSTSTR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|