C28H36N8O4S — CID 121280170
3-[2-[4-[2-(diethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-N,N-dimethylindole-1-sulfinamide (PubChem CID 121280170) has the molecular formula C28H36N8O4S and a molecular weight of 580.72 g/mol. Its IUPAC name is 3-[2-[4-[2-(diethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-N,N-dimethylindole-1-sulfinamide.
| Compound Name | 3-[2-[4-[2-(diethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-N,N-dimethylindole-1-sulfinamide |
|---|---|
| PubChem CID | 121280170 |
| Molecular Formula | C28H36N8O4S |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 3-[2-[4-[2-(diethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-N,N-dimethylindole-1-sulfinamide |
| SMILES | CCN(CC)CCN(C)c1cc(OC)c(Nc2nccc(-c3cn(S(=O)N(C)C)c4ccccc34)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H36N8O4S/c1-7-34(8-2)16-15-33(5)25-18-27(40-6)23(17-26(25)36(37)38)31-28-29-14-13-22(30-28)21-19-35(41(39)32(3)4)24-12-10-9-11-20(21)24/h9-14,17-19H,7-8,15-16H2,1-6H3,(H,29,30,31) |
| InChIKey | YHXKHKJUPXLFAR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 121.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|