C26H31N7O3 — CID 130208377
[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]pyrimidin-4-yl]-1-methylindol-2-yl]methanol (PubChem CID 130208377) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is [3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]pyrimidin-4-yl]-1-methylindol-2-yl]methanol.
| Compound Name | [3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]pyrimidin-4-yl]-1-methylindol-2-yl]methanol |
|---|---|
| PubChem CID | 130208377 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | [3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]pyrimidin-4-yl]-1-methylindol-2-yl]methanol |
| SMILES | Cc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2c(CO)n(C)c3ccccc23)n1 |
| InChI | InChI=1S/C26H31N7O3/c1-17-14-22(31(4)13-12-30(2)3)23(33(35)36)15-20(17)29-26-27-11-10-19(28-26)25-18-8-6-7-9-21(18)32(5)24(25)16-34/h6-11,14-15,34H,12-13,16H2,1-5H3,(H,27,28,29) |
| InChIKey | WIUXRZXVDCRSOM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|