C28H35N7O — CID 148555791
1-[3-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]pyrimidin-4-yl]-1-methylindol-2-yl]propan-1-one (PubChem CID 148555791) has the molecular formula C28H35N7O and a molecular weight of 485.64 g/mol. Its IUPAC name is 1-[3-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]pyrimidin-4-yl]-1-methylindol-2-yl]propan-1-one.
| Compound Name | 1-[3-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]pyrimidin-4-yl]-1-methylindol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 148555791 |
| Molecular Formula | C28H35N7O |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 1-[3-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]pyrimidin-4-yl]-1-methylindol-2-yl]propan-1-one |
| SMILES | CCC(=O)c1c(-c2ccnc(Nc3cc(N)c(N(C)CCN(C)C)cc3C)n2)c2ccccc2n1C |
| InChI | InChI=1S/C28H35N7O/c1-7-25(36)27-26(19-10-8-9-11-23(19)35(27)6)21-12-13-30-28(31-21)32-22-17-20(29)24(16-18(22)2)34(5)15-14-33(3)4/h8-13,16-17H,7,14-15,29H2,1-6H3,(H,30,31,32) |
| InChIKey | MUAPYTQUMPQJPF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|