C24H30N8O — CID 146585951
1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]pyrimidin-4-yl]-3-methylbenzimidazol-2-one (PubChem CID 146585951) has the molecular formula C24H30N8O and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]pyrimidin-4-yl]-3-methylbenzimidazol-2-one.
| Compound Name | 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]pyrimidin-4-yl]-3-methylbenzimidazol-2-one |
|---|---|
| PubChem CID | 146585951 |
| Molecular Formula | C24H30N8O |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]pyrimidin-4-yl]-3-methylbenzimidazol-2-one |
| SMILES | Cc1cc(N(C)CCN(C)C)c(N)cc1Nc1nccc(-n2c(=O)n(C)c3ccccc32)n1 |
| InChI | InChI=1S/C24H30N8O/c1-16-14-21(30(4)13-12-29(2)3)17(25)15-18(16)27-23-26-11-10-22(28-23)32-20-9-7-6-8-19(20)31(5)24(32)33/h6-11,14-15H,12-13,25H2,1-5H3,(H,26,27,28) |
| InChIKey | GZYDRKZOROHUKL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|