C25H30N8O2 — CID 135203794
1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]pyrimidin-4-yl]indole-5-carboxamide (PubChem CID 135203794) has the molecular formula C25H30N8O2 and a molecular weight of 474.57 g/mol. Its IUPAC name is 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]pyrimidin-4-yl]indole-5-carboxamide.
| Compound Name | 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]pyrimidin-4-yl]indole-5-carboxamide |
|---|---|
| PubChem CID | 135203794 |
| Molecular Formula | C25H30N8O2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]pyrimidin-4-yl]indole-5-carboxamide |
| SMILES | COc1cc(N(C)CCN(C)C)c(N)cc1Nc1nccc(-n2ccc3cc(C(N)=O)ccc32)n1 |
| InChI | InChI=1S/C25H30N8O2/c1-31(2)11-12-32(3)21-15-22(35-4)19(14-18(21)26)29-25-28-9-7-23(30-25)33-10-8-16-13-17(24(27)34)5-6-20(16)33/h5-10,13-15H,11-12,26H2,1-4H3,(H2,27,34)(H,28,29,30) |
| InChIKey | BFIIDNHYJVPSRS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|