C27H32N8O2 — CID 126670209
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methyl-5-[[4-(3-methyl-2-oxobenzimidazol-1-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 126670209) has the molecular formula C27H32N8O2 and a molecular weight of 500.61 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methyl-5-[[4-(3-methyl-2-oxobenzimidazol-1-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methyl-5-[[4-(3-methyl-2-oxobenzimidazol-1-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126670209 |
| Molecular Formula | C27H32N8O2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methyl-5-[[4-(3-methyl-2-oxobenzimidazol-1-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-n3c(=O)n(C)c4ccccc43)n2)c(C)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C27H32N8O2/c1-7-25(36)29-20-17-19(18(2)16-23(20)33(5)15-14-32(3)4)30-26-28-13-12-24(31-26)35-22-11-9-8-10-21(22)34(6)27(35)37/h7-13,16-17H,1,14-15H2,2-6H3,(H,29,36)(H,28,30,31) |
| InChIKey | OZSNRVYMAVTPDQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|