C29H34N8O3 — CID 155465200
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 155465200) has the molecular formula C29H34N8O3 and a molecular weight of 542.64 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155465200 |
| Molecular Formula | C29H34N8O3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-n3c(=O)n4c5c(cccc53)CCC4)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C29H34N8O3/c1-6-26(38)31-20-17-21(24(40-5)18-23(20)35(4)16-15-34(2)3)32-28-30-13-12-25(33-28)37-22-11-7-9-19-10-8-14-36(27(19)22)29(37)39/h6-7,9,11-13,17-18H,1,8,10,14-16H2,2-5H3,(H,31,38)(H,30,32,33) |
| InChIKey | HGLUZOILNLSYAM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|