C33H36N8O — CID 130208444
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methyl-5-[[4-(1-methyl-2-phenylindol-3-yl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 130208444) has the molecular formula C33H36N8O and a molecular weight of 560.71 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methyl-5-[[4-(1-methyl-2-phenylindol-3-yl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methyl-5-[[4-(1-methyl-2-phenylindol-3-yl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130208444 |
| Molecular Formula | C33H36N8O |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methyl-5-[[4-(1-methyl-2-phenylindol-3-yl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncnc(-c3c(-c4ccccc4)n(C)c4ccccc34)n2)c(C)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C33H36N8O/c1-7-29(42)36-26-20-25(22(2)19-28(26)40(5)18-17-39(3)4)37-33-35-21-34-32(38-33)30-24-15-11-12-16-27(24)41(6)31(30)23-13-9-8-10-14-23/h7-16,19-21H,1,17-18H2,2-6H3,(H,36,42)(H,34,35,37,38) |
| InChIKey | CDOISGGTRDPFHQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|