C28H31N9O — CID 130398645
N-[5-[[5-cyano-4-(1-methylindazol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methylphenyl]prop-2-enamide (PubChem CID 130398645) has the molecular formula C28H31N9O and a molecular weight of 509.62 g/mol. Its IUPAC name is N-[5-[[5-cyano-4-(1-methylindazol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-cyano-4-(1-methylindazol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130398645 |
| Molecular Formula | C28H31N9O |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | N-[5-[[5-cyano-4-(1-methylindazol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(C#N)c(-c3nn(C)c4ccccc34)n2)c(C)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C28H31N9O/c1-7-25(38)31-22-15-21(18(2)14-24(22)36(5)13-12-35(3)4)32-28-30-17-19(16-29)26(33-28)27-20-10-8-9-11-23(20)37(6)34-27/h7-11,14-15,17H,1,12-13H2,2-6H3,(H,31,38)(H,30,32,33) |
| InChIKey | DYGSNQFYRHSZMT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|