C28H36N8O — CID 148944081
1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]-4-(1-methylindazol-3-yl)pyrimidin-5-yl]butan-2-one (PubChem CID 148944081) has the molecular formula C28H36N8O and a molecular weight of 500.65 g/mol. Its IUPAC name is 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]-4-(1-methylindazol-3-yl)pyrimidin-5-yl]butan-2-one.
| Compound Name | 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]-4-(1-methylindazol-3-yl)pyrimidin-5-yl]butan-2-one |
|---|---|
| PubChem CID | 148944081 |
| Molecular Formula | C28H36N8O |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 1-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]-4-(1-methylindazol-3-yl)pyrimidin-5-yl]butan-2-one |
| SMILES | CCC(=O)Cc1cnc(Nc2cc(N)c(N(C)CCN(C)C)cc2C)nc1-c1nn(C)c2ccccc12 |
| InChI | InChI=1S/C28H36N8O/c1-7-20(37)15-19-17-30-28(32-26(19)27-21-10-8-9-11-24(21)36(6)33-27)31-23-16-22(29)25(14-18(23)2)35(5)13-12-34(3)4/h8-11,14,16-17H,7,12-13,15,29H2,1-6H3,(H,30,31,32) |
| InChIKey | POMJOTMYNCPUIN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|