C27H35N9O — CID 162255075
N-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]-4-(1-methylindazol-3-yl)pyrimidin-5-yl]propanamide (PubChem CID 162255075) has the molecular formula C27H35N9O and a molecular weight of 501.64 g/mol. Its IUPAC name is N-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]-4-(1-methylindazol-3-yl)pyrimidin-5-yl]propanamide.
| Compound Name | N-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]-4-(1-methylindazol-3-yl)pyrimidin-5-yl]propanamide |
|---|---|
| PubChem CID | 162255075 |
| Molecular Formula | C27H35N9O |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | N-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methylanilino]-4-(1-methylindazol-3-yl)pyrimidin-5-yl]propanamide |
| SMILES | CCC(=O)Nc1cnc(Nc2cc(N)c(N(C)CCN(C)C)cc2C)nc1-c1nn(C)c2ccccc12 |
| InChI | InChI=1S/C27H35N9O/c1-7-24(37)30-21-16-29-27(32-26(21)25-18-10-8-9-11-22(18)36(6)33-25)31-20-15-19(28)23(14-17(20)2)35(5)13-12-34(3)4/h8-11,14-16H,7,12-13,28H2,1-6H3,(H,30,37)(H,29,31,32) |
| InChIKey | IPGYUTPISDETMV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|