C22H20FN7O4 — CID 118618137
N-[2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindazol-3-yl)pyrimidin-5-yl]propanamide (PubChem CID 118618137) has the molecular formula C22H20FN7O4 and a molecular weight of 465.45 g/mol. Its IUPAC name is N-[2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindazol-3-yl)pyrimidin-5-yl]propanamide.
| Compound Name | N-[2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindazol-3-yl)pyrimidin-5-yl]propanamide |
|---|---|
| PubChem CID | 118618137 |
| Molecular Formula | C22H20FN7O4 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-[2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindazol-3-yl)pyrimidin-5-yl]propanamide |
| SMILES | CCC(=O)Nc1cnc(Nc2cc([N+](=O)[O-])c(F)cc2OC)nc1-c1nn(C)c2ccccc12 |
| InChI | InChI=1S/C22H20FN7O4/c1-4-19(31)25-15-11-24-22(26-14-10-17(30(32)33)13(23)9-18(14)34-3)27-21(15)20-12-7-5-6-8-16(12)29(2)28-20/h5-11H,4H2,1-3H3,(H,25,31)(H,24,26,27) |
| InChIKey | GXOAQFGYYOMWLQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|