C23H25N7O4 — CID 121396151
N-[4-[2-(dimethylamino)ethoxy]-2-methoxy-5-nitrophenyl]-4-(1-methylindazol-3-yl)pyrimidin-2-amine (PubChem CID 121396151) has the molecular formula C23H25N7O4 and a molecular weight of 463.50 g/mol. Its IUPAC name is N-[4-[2-(dimethylamino)ethoxy]-2-methoxy-5-nitrophenyl]-4-(1-methylindazol-3-yl)pyrimidin-2-amine.
| Compound Name | N-[4-[2-(dimethylamino)ethoxy]-2-methoxy-5-nitrophenyl]-4-(1-methylindazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 121396151 |
| Molecular Formula | C23H25N7O4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-[4-[2-(dimethylamino)ethoxy]-2-methoxy-5-nitrophenyl]-4-(1-methylindazol-3-yl)pyrimidin-2-amine |
| SMILES | COc1cc(OCCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2nn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C23H25N7O4/c1-28(2)11-12-34-21-14-20(33-4)17(13-19(21)30(31)32)26-23-24-10-9-16(25-23)22-15-7-5-6-8-18(15)29(3)27-22/h5-10,13-14H,11-12H2,1-4H3,(H,24,25,26) |
| InChIKey | NHIDDHXZUDINPR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|