C23H23ClN6O3 — CID 165389251
N-[2-chloro-4-[2-(dimethylamino)ethoxy]-5-nitrophenyl]-4-(1-methylindol-3-yl)pyrimidin-2-amine (PubChem CID 165389251) has the molecular formula C23H23ClN6O3 and a molecular weight of 466.93 g/mol. Its IUPAC name is N-[2-chloro-4-[2-(dimethylamino)ethoxy]-5-nitrophenyl]-4-(1-methylindol-3-yl)pyrimidin-2-amine.
| Compound Name | N-[2-chloro-4-[2-(dimethylamino)ethoxy]-5-nitrophenyl]-4-(1-methylindol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 165389251 |
| Molecular Formula | C23H23ClN6O3 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[2-chloro-4-[2-(dimethylamino)ethoxy]-5-nitrophenyl]-4-(1-methylindol-3-yl)pyrimidin-2-amine |
| SMILES | CN(C)CCOc1cc(Cl)c(Nc2nccc(-c3cn(C)c4ccccc34)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23ClN6O3/c1-28(2)10-11-33-22-12-17(24)19(13-21(22)30(31)32)27-23-25-9-8-18(26-23)16-14-29(3)20-7-5-4-6-15(16)20/h4-9,12-14H,10-11H2,1-3H3,(H,25,26,27) |
| InChIKey | NGXRCAHUESNUFP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|