C26H28N6O5 — CID 118618533
N-[2-(2,4-dimethoxy-5-nitroanilino)-4-(1-methylindol-3-yl)pyrimidin-5-yl]-2,2-dimethylpropanamide (PubChem CID 118618533) has the molecular formula C26H28N6O5 and a molecular weight of 504.55 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxy-5-nitroanilino)-4-(1-methylindol-3-yl)pyrimidin-5-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(2,4-dimethoxy-5-nitroanilino)-4-(1-methylindol-3-yl)pyrimidin-5-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 118618533 |
| Molecular Formula | C26H28N6O5 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-[2-(2,4-dimethoxy-5-nitroanilino)-4-(1-methylindol-3-yl)pyrimidin-5-yl]-2,2-dimethylpropanamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1Nc1ncc(NC(=O)C(C)(C)C)c(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C26H28N6O5/c1-26(2,3)24(33)28-18-13-27-25(29-17-11-20(32(34)35)22(37-6)12-21(17)36-5)30-23(18)16-14-31(4)19-10-8-7-9-15(16)19/h7-14H,1-6H3,(H,28,33)(H,27,29,30) |
| InChIKey | QPPQXCLEWAPENU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|