C30H37N7O4 — CID 159320046
propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(1,6-dimethylindol-3-yl)pyrimidine-5-carboxylate (PubChem CID 159320046) has the molecular formula C30H37N7O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(1,6-dimethylindol-3-yl)pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(1,6-dimethylindol-3-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 159320046 |
| Molecular Formula | C30H37N7O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-nitroanilino]-4-(1,6-dimethylindol-3-yl)pyrimidine-5-carboxylate |
| SMILES | Cc1ccc2c(-c3nc(Nc4cc([N+](=O)[O-])c(N(C)CCN(C)C)cc4C)ncc3C(=O)OC(C)C)cn(C)c2c1 |
| InChI | InChI=1S/C30H37N7O4/c1-18(2)41-29(38)22-16-31-30(33-28(22)23-17-36(8)25-13-19(3)9-10-21(23)25)32-24-15-27(37(39)40)26(14-20(24)4)35(7)12-11-34(5)6/h9-10,13-18H,11-12H2,1-8H3,(H,31,32,33) |
| InChIKey | XSJLESGQZWBZAQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|