C31H41N7O6 — CID 158702374
methane;propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(7-methoxy-1-methylindol-3-yl)pyrimidine-5-carboxylate (PubChem CID 158702374) has the molecular formula C31H41N7O6 and a molecular weight of 607.71 g/mol. Its IUPAC name is methane;propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(7-methoxy-1-methylindol-3-yl)pyrimidine-5-carboxylate.
| Compound Name | methane;propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(7-methoxy-1-methylindol-3-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 158702374 |
| Molecular Formula | C31H41N7O6 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | methane;propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(7-methoxy-1-methylindol-3-yl)pyrimidine-5-carboxylate |
| SMILES | C.COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(C(=O)OC(C)C)c(-c2cn(C)c3c(OC)cccc23)n1 |
| InChI | InChI=1S/C30H37N7O6.CH4/c1-18(2)43-29(38)20-16-31-30(33-27(20)21-17-36(6)28-19(21)10-9-11-25(28)41-7)32-22-14-24(37(39)40)23(15-26(22)42-8)35(5)13-12-34(3)4;/h9-11,14-18H,12-13H2,1-8H3,(H,31,32,33);1H4 |
| InChIKey | IHRWLROAGUMIDY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|