C28H34N8O4 — CID 155176369
N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidin-5-yl]-2-methylpropanamide (PubChem CID 155176369) has the molecular formula C28H34N8O4 and a molecular weight of 546.63 g/mol. Its IUPAC name is N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidin-5-yl]-2-methylpropanamide.
| Compound Name | N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidin-5-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 155176369 |
| Molecular Formula | C28H34N8O4 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | N-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidin-5-yl]-2-methylpropanamide |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(NC(=O)C(C)C)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C28H34N8O4/c1-17(2)27(37)31-22-16-30-28(33-26(22)19-15-29-20-10-8-7-9-18(19)20)32-21-13-24(36(38)39)23(14-25(21)40-6)35(5)12-11-34(3)4/h7-10,13-17,29H,11-12H2,1-6H3,(H,31,37)(H,30,32,33) |
| InChIKey | IOWCRXMEWZFDOC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|