C26H31N9O4 — CID 155176362
1-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidin-5-yl]-3-methylurea (PubChem CID 155176362) has the molecular formula C26H31N9O4 and a molecular weight of 533.59 g/mol. Its IUPAC name is 1-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidin-5-yl]-3-methylurea.
| Compound Name | 1-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidin-5-yl]-3-methylurea |
|---|---|
| PubChem CID | 155176362 |
| Molecular Formula | C26H31N9O4 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 1-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidin-5-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1cnc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC)nc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H31N9O4/c1-27-26(36)31-20-15-29-25(32-24(20)17-14-28-18-9-7-6-8-16(17)18)30-19-12-22(35(37)38)21(13-23(19)39-5)34(4)11-10-33(2)3/h6-9,12-15,28H,10-11H2,1-5H3,(H2,27,31,36)(H,29,30,32) |
| InChIKey | BSJRLVCRDINENF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 153.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|