C28H33Cl2FN8O2 — CID 142342747
2-chloro-N-[2-[5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyanilino]ethyl]-2-fluoroacetamide (PubChem CID 142342747) has the molecular formula C28H33Cl2FN8O2 and a molecular weight of 603.53 g/mol. Its IUPAC name is 2-chloro-N-[2-[5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyanilino]ethyl]-2-fluoroacetamide.
| Compound Name | 2-chloro-N-[2-[5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyanilino]ethyl]-2-fluoroacetamide |
|---|---|
| PubChem CID | 142342747 |
| Molecular Formula | C28H33Cl2FN8O2 |
| Molecular Weight | 603.53 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 2-chloro-N-[2-[5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyanilino]ethyl]-2-fluoroacetamide |
| SMILES | COc1cc(N(C)CCN(C)C)c(NCCNC(=O)C(F)Cl)cc1Nc1ncc(Cl)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C28H33Cl2FN8O2/c1-38(2)11-12-39(3)23-14-24(41-4)22(13-21(23)32-9-10-33-27(40)26(30)31)36-28-35-16-19(29)25(37-28)18-15-34-20-8-6-5-7-17(18)20/h5-8,13-16,26,32,34H,9-12H2,1-4H3,(H,33,40)(H,35,36,37) |
| InChIKey | SWDSEXYDFKHVMX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|