C23H25ClN6O2 — CID 118913189
1-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]-4-[2-(dimethylamino)ethoxy]-6-methoxybenzene-1,3-diamine (PubChem CID 118913189) has the molecular formula C23H25ClN6O2 and a molecular weight of 452.95 g/mol. Its IUPAC name is 1-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]-4-[2-(dimethylamino)ethoxy]-6-methoxybenzene-1,3-diamine.
| Compound Name | 1-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]-4-[2-(dimethylamino)ethoxy]-6-methoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 118913189 |
| Molecular Formula | C23H25ClN6O2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]-4-[2-(dimethylamino)ethoxy]-6-methoxybenzene-1,3-diamine |
| SMILES | COc1cc(OCCN(C)C)c(N)cc1Nc1ncc(Cl)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C23H25ClN6O2/c1-30(2)8-9-32-20-11-21(31-3)19(10-17(20)25)28-23-27-13-16(24)22(29-23)15-12-26-18-7-5-4-6-14(15)18/h4-7,10-13,26H,8-9,25H2,1-3H3,(H,27,28,29) |
| InChIKey | MBABJHDLSFKHCY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|