C24H26ClN7O — CID 73292722
3-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]-4-methoxy-6-(4-methylpiperazin-1-yl)benzene-1,3-diamine (PubChem CID 73292722) has the molecular formula C24H26ClN7O and a molecular weight of 463.97 g/mol. Its IUPAC name is 3-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]-4-methoxy-6-(4-methylpiperazin-1-yl)benzene-1,3-diamine.
| Compound Name | 3-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]-4-methoxy-6-(4-methylpiperazin-1-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 73292722 |
| Molecular Formula | C24H26ClN7O |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]-4-methoxy-6-(4-methylpiperazin-1-yl)benzene-1,3-diamine |
| SMILES | COc1cc(N2CCN(C)CC2)c(N)cc1Nc1ncc(Cl)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C24H26ClN7O/c1-31-7-9-32(10-8-31)21-12-22(33-2)20(11-18(21)26)29-24-28-14-17(25)23(30-24)16-13-27-19-6-4-3-5-15(16)19/h3-6,11-14,27H,7-10,26H2,1-2H3,(H,28,29,30) |
| InChIKey | YHXYKBNHKAYLBY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|