C27H31ClN6O3 — CID 118912937
3-N-[5-chloro-4-(1-methylindol-3-yl)pyrimidin-2-yl]-4-methoxy-6-(3-morpholin-4-ylpropoxy)benzene-1,3-diamine (PubChem CID 118912937) has the molecular formula C27H31ClN6O3 and a molecular weight of 523.04 g/mol. Its IUPAC name is 3-N-[5-chloro-4-(1-methylindol-3-yl)pyrimidin-2-yl]-4-methoxy-6-(3-morpholin-4-ylpropoxy)benzene-1,3-diamine.
| Compound Name | 3-N-[5-chloro-4-(1-methylindol-3-yl)pyrimidin-2-yl]-4-methoxy-6-(3-morpholin-4-ylpropoxy)benzene-1,3-diamine |
|---|---|
| PubChem CID | 118912937 |
| Molecular Formula | C27H31ClN6O3 |
| Molecular Weight | 523.04 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 3-N-[5-chloro-4-(1-methylindol-3-yl)pyrimidin-2-yl]-4-methoxy-6-(3-morpholin-4-ylpropoxy)benzene-1,3-diamine |
| SMILES | COc1cc(OCCCN2CCOCC2)c(N)cc1Nc1ncc(Cl)c(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C27H31ClN6O3/c1-33-17-19(18-6-3-4-7-23(18)33)26-20(28)16-30-27(32-26)31-22-14-21(29)24(15-25(22)35-2)37-11-5-8-34-9-12-36-13-10-34/h3-4,6-7,14-17H,5,8-13,29H2,1-2H3,(H,30,31,32) |
| InChIKey | IOAWGGRSWPAUAI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.04 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|