C32H38ClFN6O3 — CID 145022864
N-[5-[[5-chloro-4-(1-methyl-6-morpholin-4-ylindol-3-yl)pyrimidin-2-yl]amino]-2-fluoro-4-methoxyphenyl]prop-2-enamide;ethane;prop-1-ene (PubChem CID 145022864) has the molecular formula C32H38ClFN6O3 and a molecular weight of 609.15 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(1-methyl-6-morpholin-4-ylindol-3-yl)pyrimidin-2-yl]amino]-2-fluoro-4-methoxyphenyl]prop-2-enamide;ethane;prop-1-ene.
| Compound Name | N-[5-[[5-chloro-4-(1-methyl-6-morpholin-4-ylindol-3-yl)pyrimidin-2-yl]amino]-2-fluoro-4-methoxyphenyl]prop-2-enamide;ethane;prop-1-ene |
|---|---|
| PubChem CID | 145022864 |
| Molecular Formula | C32H38ClFN6O3 |
| Molecular Weight | 609.15 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | N-[5-[[5-chloro-4-(1-methyl-6-morpholin-4-ylindol-3-yl)pyrimidin-2-yl]amino]-2-fluoro-4-methoxyphenyl]prop-2-enamide;ethane;prop-1-ene |
| SMILES | C=CC.C=CC(=O)Nc1cc(Nc2ncc(Cl)c(-c3cn(C)c4cc(N5CCOCC5)ccc34)n2)c(OC)cc1F.CC |
| InChI | InChI=1S/C27H26ClFN6O3.C3H6.C2H6/c1-4-25(36)31-21-13-22(24(37-3)12-20(21)29)32-27-30-14-19(28)26(33-27)18-15-34(2)23-11-16(5-6-17(18)23)35-7-9-38-10-8-35;1-3-2;1-2/h4-6,11-15H,1,7-10H2,2-3H3,(H,31,36)(H,30,32,33);3H,1H2,2H3;1-2H3 |
| InChIKey | AGWVFHUGIXOMBI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.15 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|