C30H34N6O7S — CID 138647757
[3-[2-[2-methoxy-4-(2-morpholin-4-ylethoxy)-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]-1-methylindol-6-yl]methanesulfonic acid (PubChem CID 138647757) has the molecular formula C30H34N6O7S and a molecular weight of 622.70 g/mol. Its IUPAC name is [3-[2-[2-methoxy-4-(2-morpholin-4-ylethoxy)-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]-1-methylindol-6-yl]methanesulfonic acid.
| Compound Name | [3-[2-[2-methoxy-4-(2-morpholin-4-ylethoxy)-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]-1-methylindol-6-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 138647757 |
| Molecular Formula | C30H34N6O7S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | [3-[2-[2-methoxy-4-(2-morpholin-4-ylethoxy)-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]-1-methylindol-6-yl]methanesulfonic acid |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4cc(CS(=O)(=O)O)ccc34)n2)c(OC)cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C30H34N6O7S/c1-4-29(37)32-25-16-24(27(41-3)17-28(25)43-14-11-36-9-12-42-13-10-36)34-30-31-8-7-23(33-30)22-18-35(2)26-15-20(5-6-21(22)26)19-44(38,39)40/h4-8,15-18H,1,9-14,19H2,2-3H3,(H,32,37)(H,31,33,34)(H,38,39,40) |
| InChIKey | CXWIXKAKWWHGFL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 157.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|