C32H37N7O4 — CID 171103737
(E)-N-[4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]-4-morpholin-4-ylbut-2-enamide (PubChem CID 171103737) has the molecular formula C32H37N7O4 and a molecular weight of 583.69 g/mol. Its IUPAC name is (E)-N-[4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]-4-morpholin-4-ylbut-2-enamide.
| Compound Name | (E)-N-[4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]-4-morpholin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 171103737 |
| Molecular Formula | C32H37N7O4 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | (E)-N-[4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]-4-morpholin-4-ylbut-2-enamide |
| SMILES | COc1cc(N2CCOCC2)c(NC(=O)/C=C/CN2CCOCC2)cc1Nc1nccc(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C32H37N7O4/c1-37-22-24(23-6-3-4-7-28(23)37)25-9-10-33-32(35-25)36-27-20-26(29(21-30(27)41-2)39-14-18-43-19-15-39)34-31(40)8-5-11-38-12-16-42-17-13-38/h3-10,20-22H,11-19H2,1-2H3,(H,34,40)(H,33,35,36)/b8-5+ |
| InChIKey | HPRHLJMQSIVSDA-VMPITWQZSA-N |
| XLogP | 4.05 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|