C25H24ClN7O2 — CID 164911621
N-[3-[5-chloro-2-[(6-morpholin-4-yl-3-pyridinyl)amino]pyrimidin-4-yl]-1-methylindol-6-yl]prop-2-enamide (PubChem CID 164911621) has the molecular formula C25H24ClN7O2 and a molecular weight of 489.97 g/mol. Its IUPAC name is N-[3-[5-chloro-2-[(6-morpholin-4-yl-3-pyridinyl)amino]pyrimidin-4-yl]-1-methylindol-6-yl]prop-2-enamide.
| Compound Name | N-[3-[5-chloro-2-[(6-morpholin-4-yl-3-pyridinyl)amino]pyrimidin-4-yl]-1-methylindol-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 164911621 |
| Molecular Formula | C25H24ClN7O2 |
| Molecular Weight | 489.97 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-[3-[5-chloro-2-[(6-morpholin-4-yl-3-pyridinyl)amino]pyrimidin-4-yl]-1-methylindol-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(-c3nc(Nc4ccc(N5CCOCC5)nc4)ncc3Cl)cn(C)c2c1 |
| InChI | InChI=1S/C25H24ClN7O2/c1-3-23(34)29-16-4-6-18-19(15-32(2)21(18)12-16)24-20(26)14-28-25(31-24)30-17-5-7-22(27-13-17)33-8-10-35-11-9-33/h3-7,12-15H,1,8-11H2,2H3,(H,29,34)(H,28,30,31) |
| InChIKey | BATBVHWFDKNOJL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.97 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|