C23H23ClN5O6P — CID 118595902
[5-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl] dihydrogen phosphate (PubChem CID 118595902) has the molecular formula C23H23ClN5O6P and a molecular weight of 531.89 g/mol. Its IUPAC name is [5-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl] dihydrogen phosphate.
| Compound Name | [5-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118595902 |
| Molecular Formula | C23H23ClN5O6P |
| Molecular Weight | 531.89 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | [5-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl] dihydrogen phosphate |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(Nc3ccc(N4CCOCC4)c(OP(=O)(O)O)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C23H23ClN5O6P/c1-2-21(30)26-16-5-3-4-15(12-16)22-18(24)14-25-23(28-22)27-17-6-7-19(29-8-10-34-11-9-29)20(13-17)35-36(31,32)33/h2-7,12-14H,1,8-11H2,(H,26,30)(H,25,27,28)(H2,31,32,33) |
| InChIKey | TWODRPMBWBTTPV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 146.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|