C30H38ClN7O2 — CID 154987294
N-[3-[5-chloro-2-[3-[3-[4-(3-methoxypropyl)piperazin-1-yl]propylamino]anilino]pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 154987294) has the molecular formula C30H38ClN7O2 and a molecular weight of 564.13 g/mol. Its IUPAC name is N-[3-[5-chloro-2-[3-[3-[4-(3-methoxypropyl)piperazin-1-yl]propylamino]anilino]pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[5-chloro-2-[3-[3-[4-(3-methoxypropyl)piperazin-1-yl]propylamino]anilino]pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154987294 |
| Molecular Formula | C30H38ClN7O2 |
| Molecular Weight | 564.13 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | N-[3-[5-chloro-2-[3-[3-[4-(3-methoxypropyl)piperazin-1-yl]propylamino]anilino]pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(Nc3cccc(NCCCN4CCN(CCCOC)CC4)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C30H38ClN7O2/c1-3-28(39)34-25-10-4-8-23(20-25)29-27(31)22-33-30(36-29)35-26-11-5-9-24(21-26)32-12-6-13-37-15-17-38(18-16-37)14-7-19-40-2/h3-5,8-11,20-22,32H,1,6-7,12-19H2,2H3,(H,34,39)(H,33,35,36) |
| InChIKey | TVACHWBFSJJPFG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.13 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|