C34H35ClN6O3 — CID 138650505
N-[3-[[4-(3-but-3-enoxyphenyl)-5-chloropyrimidin-2-yl]amino]-5-[[ethyl(methyl)amino]methyl]phenyl]-3-(prop-2-enoylamino)benzamide (PubChem CID 138650505) has the molecular formula C34H35ClN6O3 and a molecular weight of 611.15 g/mol. Its IUPAC name is N-[3-[[4-(3-but-3-enoxyphenyl)-5-chloropyrimidin-2-yl]amino]-5-[[ethyl(methyl)amino]methyl]phenyl]-3-(prop-2-enoylamino)benzamide.
| Compound Name | N-[3-[[4-(3-but-3-enoxyphenyl)-5-chloropyrimidin-2-yl]amino]-5-[[ethyl(methyl)amino]methyl]phenyl]-3-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 138650505 |
| Molecular Formula | C34H35ClN6O3 |
| Molecular Weight | 611.15 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | N-[3-[[4-(3-but-3-enoxyphenyl)-5-chloropyrimidin-2-yl]amino]-5-[[ethyl(methyl)amino]methyl]phenyl]-3-(prop-2-enoylamino)benzamide |
| SMILES | C=CCCOc1cccc(-c2nc(Nc3cc(CN(C)CC)cc(NC(=O)c4cccc(NC(=O)C=C)c4)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C34H35ClN6O3/c1-5-8-15-44-29-14-10-11-24(19-29)32-30(35)21-36-34(40-32)39-28-17-23(22-41(4)7-3)16-27(20-28)38-33(43)25-12-9-13-26(18-25)37-31(42)6-2/h5-6,9-14,16-21H,1-2,7-8,15,22H2,3-4H3,(H,37,42)(H,38,43)(H,36,39,40) |
| InChIKey | ZFFHVMHCLISPOT-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.15 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|