C36H47N7O3 — CID 155135935
N-[3-[[4-(3-but-3-enoxyphenyl)pyrimidin-2-yl]amino]-5-[[ethyl(methyl)amino]methyl]phenyl]-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidine-4-carboxamide (PubChem CID 155135935) has the molecular formula C36H47N7O3 and a molecular weight of 625.82 g/mol. Its IUPAC name is N-[3-[[4-(3-but-3-enoxyphenyl)pyrimidin-2-yl]amino]-5-[[ethyl(methyl)amino]methyl]phenyl]-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-[3-[[4-(3-but-3-enoxyphenyl)pyrimidin-2-yl]amino]-5-[[ethyl(methyl)amino]methyl]phenyl]-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155135935 |
| Molecular Formula | C36H47N7O3 |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 625.37 |
| IUPAC Name | N-[3-[[4-(3-but-3-enoxyphenyl)pyrimidin-2-yl]amino]-5-[[ethyl(methyl)amino]methyl]phenyl]-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidine-4-carboxamide |
| SMILES | C=CCCOc1cccc(-c2ccnc(Nc3cc(CN(C)CC)cc(NC(=O)C4CCN(C(=O)/C=C/CN(C)C)CC4)c3)n2)c1 |
| InChI | InChI=1S/C36H47N7O3/c1-6-8-21-46-32-12-9-11-29(24-32)33-14-17-37-36(40-33)39-31-23-27(26-42(5)7-2)22-30(25-31)38-35(45)28-15-19-43(20-16-28)34(44)13-10-18-41(3)4/h6,9-14,17,22-25,28H,1,7-8,15-16,18-21,26H2,2-5H3,(H,38,45)(H,37,39,40)/b13-10+ |
| InChIKey | WFICDVPYFZVCCV-JLHYYAGUSA-N |
| XLogP | 5.59 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|