C32H40N8O3 — CID 118420598
(E)-1-[(3S)-3-[6-(benzylamino)-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 118420598) has the molecular formula C32H40N8O3 and a molecular weight of 584.73 g/mol. Its IUPAC name is (E)-1-[(3S)-3-[6-(benzylamino)-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | (E)-1-[(3S)-3-[6-(benzylamino)-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 118420598 |
| Molecular Formula | C32H40N8O3 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | (E)-1-[(3S)-3-[6-(benzylamino)-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | COCCOc1ccc(Nc2nc(NCc3ccccc3)c3ncn([C@H]4CCCN(C(=O)/C=C/CN(C)C)C4)c3n2)cc1 |
| InChI | InChI=1S/C32H40N8O3/c1-38(2)17-8-12-28(41)39-18-7-11-26(22-39)40-23-34-29-30(33-21-24-9-5-4-6-10-24)36-32(37-31(29)40)35-25-13-15-27(16-14-25)43-20-19-42-3/h4-6,8-10,12-16,23,26H,7,11,17-22H2,1-3H3,(H2,33,35,36,37)/b12-8+/t26-/m0/s1 |
| InChIKey | YEESAMLPENJFIG-ZDADTQBUSA-N |
| XLogP | 4.49 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|