C26H31N7O2 — CID 118420711
6-N-benzyl-2-N-[3-(2-methoxyethoxy)phenyl]-9-[(3S)-piperidin-3-yl]purine-2,6-diamine (PubChem CID 118420711) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 6-N-benzyl-2-N-[3-(2-methoxyethoxy)phenyl]-9-[(3S)-piperidin-3-yl]purine-2,6-diamine.
| Compound Name | 6-N-benzyl-2-N-[3-(2-methoxyethoxy)phenyl]-9-[(3S)-piperidin-3-yl]purine-2,6-diamine |
|---|---|
| PubChem CID | 118420711 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 6-N-benzyl-2-N-[3-(2-methoxyethoxy)phenyl]-9-[(3S)-piperidin-3-yl]purine-2,6-diamine |
| SMILES | COCCOc1cccc(Nc2nc(NCc3ccccc3)c3ncn([C@H]4CCCNC4)c3n2)c1 |
| InChI | InChI=1S/C26H31N7O2/c1-34-13-14-35-22-11-5-9-20(15-22)30-26-31-24(28-16-19-7-3-2-4-8-19)23-25(32-26)33(18-29-23)21-10-6-12-27-17-21/h2-5,7-9,11,15,18,21,27H,6,10,12-14,16-17H2,1H3,(H2,28,30,31,32)/t21-/m0/s1 |
| InChIKey | IJMVTXWCGSIYGR-NRFANRHFSA-N |
| XLogP | 4.13 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|