C29H32FN7O3 — CID 118421149
1-[(3S)-3-[6-(benzylamino)-2-[3-fluoro-4-(2-methoxyethoxy)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 118421149) has the molecular formula C29H32FN7O3 and a molecular weight of 545.62 g/mol. Its IUPAC name is 1-[(3S)-3-[6-(benzylamino)-2-[3-fluoro-4-(2-methoxyethoxy)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[6-(benzylamino)-2-[3-fluoro-4-(2-methoxyethoxy)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118421149 |
| Molecular Formula | C29H32FN7O3 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 1-[(3S)-3-[6-(benzylamino)-2-[3-fluoro-4-(2-methoxyethoxy)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H](n2cnc3c(NCc4ccccc4)nc(Nc4ccc(OCCOC)c(F)c4)nc32)C1 |
| InChI | InChI=1S/C29H32FN7O3/c1-3-25(38)36-13-7-10-22(18-36)37-19-32-26-27(31-17-20-8-5-4-6-9-20)34-29(35-28(26)37)33-21-11-12-24(23(30)16-21)40-15-14-39-2/h3-6,8-9,11-12,16,19,22H,1,7,10,13-15,17-18H2,2H3,(H2,31,33,34,35)/t22-/m0/s1 |
| InChIKey | KVHHBTYJSVASEB-QFIPXVFZSA-N |
| XLogP | 4.70 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|