C23H26F2N8O2 — CID 118420912
1-[(3S)-3-[6-amino-2-(3,5-difluoro-4-morpholin-4-ylanilino)purin-9-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 118420912) has the molecular formula C23H26F2N8O2 and a molecular weight of 484.51 g/mol. Its IUPAC name is 1-[(3S)-3-[6-amino-2-(3,5-difluoro-4-morpholin-4-ylanilino)purin-9-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[6-amino-2-(3,5-difluoro-4-morpholin-4-ylanilino)purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118420912 |
| Molecular Formula | C23H26F2N8O2 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 1-[(3S)-3-[6-amino-2-(3,5-difluoro-4-morpholin-4-ylanilino)purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H](n2cnc3c(N)nc(Nc4cc(F)c(N5CCOCC5)c(F)c4)nc32)C1 |
| InChI | InChI=1S/C23H26F2N8O2/c1-2-18(34)32-5-3-4-15(12-32)33-13-27-19-21(26)29-23(30-22(19)33)28-14-10-16(24)20(17(25)11-14)31-6-8-35-9-7-31/h2,10-11,13,15H,1,3-9,12H2,(H3,26,28,29,30)/t15-/m0/s1 |
| InChIKey | BIHPTHFVWYBPNR-HNNXBMFYSA-N |
| XLogP | 2.62 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|