C32H39N9O2 — CID 144937279
1-[3-[6-(benzylamino)-2-[4-(2-morpholin-4-ylethylamino)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 144937279) has the molecular formula C32H39N9O2 and a molecular weight of 581.73 g/mol. Its IUPAC name is 1-[3-[6-(benzylamino)-2-[4-(2-morpholin-4-ylethylamino)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[6-(benzylamino)-2-[4-(2-morpholin-4-ylethylamino)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 144937279 |
| Molecular Formula | C32H39N9O2 |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 1-[3-[6-(benzylamino)-2-[4-(2-morpholin-4-ylethylamino)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2cnc3c(NCc4ccccc4)nc(Nc4ccc(NCCN5CCOCC5)cc4)nc32)C1 |
| InChI | InChI=1S/C32H39N9O2/c1-2-28(42)40-15-6-9-27(22-40)41-23-35-29-30(34-21-24-7-4-3-5-8-24)37-32(38-31(29)41)36-26-12-10-25(11-13-26)33-14-16-39-17-19-43-20-18-39/h2-5,7-8,10-13,23,27,33H,1,6,9,14-22H2,(H2,34,36,37,38) |
| InChIKey | DLSMLPGRCSBZJY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|