C34H37N7O3 — CID 118420794
tert-butyl (3S)-3-[6-(benzylamino)-2-(4-phenoxyanilino)purin-9-yl]piperidine-1-carboxylate (PubChem CID 118420794) has the molecular formula C34H37N7O3 and a molecular weight of 591.72 g/mol. Its IUPAC name is tert-butyl (3S)-3-[6-(benzylamino)-2-(4-phenoxyanilino)purin-9-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[6-(benzylamino)-2-(4-phenoxyanilino)purin-9-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118420794 |
| Molecular Formula | C34H37N7O3 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | tert-butyl (3S)-3-[6-(benzylamino)-2-(4-phenoxyanilino)purin-9-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](n2cnc3c(NCc4ccccc4)nc(Nc4ccc(Oc5ccccc5)cc4)nc32)C1 |
| InChI | InChI=1S/C34H37N7O3/c1-34(2,3)44-33(42)40-20-10-13-26(22-40)41-23-36-29-30(35-21-24-11-6-4-7-12-24)38-32(39-31(29)41)37-25-16-18-28(19-17-25)43-27-14-8-5-9-15-27/h4-9,11-12,14-19,23,26H,10,13,20-22H2,1-3H3,(H2,35,37,38,39)/t26-/m0/s1 |
| InChIKey | ZACBUZKHIQFFPD-SANMLTNESA-N |
| XLogP | 7.55 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |