C27H32N4O4 — CID 90194448
tert-butyl 3-[2-amino-3-carbamoyl-4-(4-phenoxyphenyl)pyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 90194448) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is tert-butyl 3-[2-amino-3-carbamoyl-4-(4-phenoxyphenyl)pyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-amino-3-carbamoyl-4-(4-phenoxyphenyl)pyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90194448 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | tert-butyl 3-[2-amino-3-carbamoyl-4-(4-phenoxyphenyl)pyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(n2cc(-c3ccc(Oc4ccccc4)cc3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C27H32N4O4/c1-27(2,3)35-26(33)30-15-7-8-19(16-30)31-17-22(23(24(31)28)25(29)32)18-11-13-21(14-12-18)34-20-9-5-4-6-10-20/h4-6,9-14,17,19H,7-8,15-16,28H2,1-3H3,(H2,29,32) |
| InChIKey | MBHBLTPPZIWNRY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |