C34H44N6O6S — CID 160916178
tert-butyl 3-methylsulfonyloxypiperidine-1-carboxylate;5-(4-phenoxyphenyl)-7-piperidin-3-ylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 160916178) has the molecular formula C34H44N6O6S and a molecular weight of 664.83 g/mol. Its IUPAC name is tert-butyl 3-methylsulfonyloxypiperidine-1-carboxylate;5-(4-phenoxyphenyl)-7-piperidin-3-ylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | tert-butyl 3-methylsulfonyloxypiperidine-1-carboxylate;5-(4-phenoxyphenyl)-7-piperidin-3-ylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 160916178 |
| Molecular Formula | C34H44N6O6S |
| Molecular Weight | 664.83 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | tert-butyl 3-methylsulfonyloxypiperidine-1-carboxylate;5-(4-phenoxyphenyl)-7-piperidin-3-ylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)OC(=O)N1CCCC(OS(C)(=O)=O)C1.Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2C1CCCNC1 |
| InChI | InChI=1S/C23H23N5O.C11H21NO5S/c24-22-21-20(14-28(23(21)27-15-26-22)17-5-4-12-25-13-17)16-8-10-19(11-9-16)29-18-6-2-1-3-7-18;1-11(2,3)16-10(13)12-7-5-6-9(8-12)17-18(4,14)15/h1-3,6-11,14-15,17,25H,4-5,12-13H2,(H2,24,26,27);9H,5-8H2,1-4H3 |
| InChIKey | SRKVNEBIPXOXSO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.83 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|