C28H33N5O3 — CID 174760975
tert-butyl formate;5-(4-phenoxyphenyl)-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 174760975) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is tert-butyl formate;5-(4-phenoxyphenyl)-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | tert-butyl formate;5-(4-phenoxyphenyl)-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 174760975 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | tert-butyl formate;5-(4-phenoxyphenyl)-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)OC=O.Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2C1CCNCC1 |
| InChI | InChI=1S/C23H23N5O.C5H10O2/c24-22-21-20(14-28(23(21)27-15-26-22)17-10-12-25-13-11-17)16-6-8-19(9-7-16)29-18-4-2-1-3-5-18;1-5(2,3)7-4-6/h1-9,14-15,17,25H,10-13H2,(H2,24,26,27);4H,1-3H3 |
| InChIKey | HUFGHKOMQLEJRO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|