C28H33B2N5O3 — CID 156857237
CID 156857237 (PubChem CID 156857237) has the molecular formula C28H33B2N5O3 and a molecular weight of 509.23 g/mol.
| Compound Name | CID 156857237 |
|---|---|
| PubChem CID | 156857237 |
| Molecular Formula | C28H33B2N5O3 |
| Molecular Weight | 509.23 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | — |
| SMILES | CC.[B]OCC(CO[B])N1CCC(n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C26H27B2N5O3.C2H6/c27-34-15-20(16-35-28)32-12-10-19(11-13-32)33-14-23(24-25(29)30-17-31-26(24)33)18-6-8-22(9-7-18)36-21-4-2-1-3-5-21;1-2/h1-9,14,17,19-20H,10-13,15-16H2,(H2,29,30,31);1-2H3 |
| InChIKey | QUWGIHPLFMVPMQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|