C26H29Cl2N5O — CID 22736348
7-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride (PubChem CID 22736348) has the molecular formula C26H29Cl2N5O and a molecular weight of 498.46 g/mol. Its IUPAC name is 7-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride.
| Compound Name | 7-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 22736348 |
| Molecular Formula | C26H29Cl2N5O |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 7-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride |
| SMILES | CN1CC2CC(n3cc(-c4ccc(Oc5ccccc5)cc4)c4c(N)ncnc43)CC2C1.Cl.Cl |
| InChI | InChI=1S/C26H27N5O.2ClH/c1-30-13-18-11-20(12-19(18)14-30)31-15-23(24-25(27)28-16-29-26(24)31)17-7-9-22(10-8-17)32-21-5-3-2-4-6-21;;/h2-10,15-16,18-20H,11-14H2,1H3,(H2,27,28,29);2*1H |
| InChIKey | RLVAWOAMIYZXCP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |