C29H34FN5O3 — CID 175290952
tert-butyl formate;5-[4-(3-fluorophenoxy)phenyl]-6-methyl-7-[(3R)-piperidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 175290952) has the molecular formula C29H34FN5O3 and a molecular weight of 519.62 g/mol. Its IUPAC name is tert-butyl formate;5-[4-(3-fluorophenoxy)phenyl]-6-methyl-7-[(3R)-piperidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | tert-butyl formate;5-[4-(3-fluorophenoxy)phenyl]-6-methyl-7-[(3R)-piperidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175290952 |
| Molecular Formula | C29H34FN5O3 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | tert-butyl formate;5-[4-(3-fluorophenoxy)phenyl]-6-methyl-7-[(3R)-piperidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)OC=O.Cc1c(-c2ccc(Oc3cccc(F)c3)cc2)c2c(N)ncnc2n1[C@@H]1CCCNC1 |
| InChI | InChI=1S/C24H24FN5O.C5H10O2/c1-15-21(16-7-9-19(10-8-16)31-20-6-2-4-17(25)12-20)22-23(26)28-14-29-24(22)30(15)18-5-3-11-27-13-18;1-5(2,3)7-4-6/h2,4,6-10,12,14,18,27H,3,5,11,13H2,1H3,(H2,26,28,29);4H,1-3H3/t18-;/m1./s1 |
| InChIKey | SSQFGKYNOJIVIX-GMUIIQOCSA-N |
| XLogP | 5.80 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|