C30H28N6O2 — CID 71014104
(E)-2-[(3R)-3-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile (PubChem CID 71014104) has the molecular formula C30H28N6O2 and a molecular weight of 504.59 g/mol. Its IUPAC name is (E)-2-[(3R)-3-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile.
| Compound Name | (E)-2-[(3R)-3-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
|---|---|
| PubChem CID | 71014104 |
| Molecular Formula | C30H28N6O2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | (E)-2-[(3R)-3-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
| SMILES | N#C/C(=C\C1CC1)C(=O)N1CCC[C@@H](n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C30H28N6O2/c31-16-22(15-20-8-9-20)30(37)35-14-4-5-23(17-35)36-18-26(27-28(32)33-19-34-29(27)36)21-10-12-25(13-11-21)38-24-6-2-1-3-7-24/h1-3,6-7,10-13,15,18-20,23H,4-5,8-9,14,17H2,(H2,32,33,34)/b22-15+/t23-/m1/s1 |
| InChIKey | QBWDAFICRCELKK-VKIDYWOHSA-N |
| XLogP | 5.50 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|